C17H17NS — CID 125481012
(5R)-2-methyl-5-phenyl-4,5-dihydro-3H-2-benzazepine-1-thione (PubChem CID 125481012) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is (5R)-2-methyl-5-phenyl-4,5-dihydro-3H-2-benzazepine-1-thione.
| Compound Name | (5R)-2-methyl-5-phenyl-4,5-dihydro-3H-2-benzazepine-1-thione |
|---|---|
| PubChem CID | 125481012 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (5R)-2-methyl-5-phenyl-4,5-dihydro-3H-2-benzazepine-1-thione |
| SMILES | CN1CC[C@H](c2ccccc2)c2ccccc2C1=S |
| InChI | InChI=1S/C17H17NS/c1-18-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17(18)19/h2-10,14H,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | ROIICBJWZAZNBQ-CQSZACIVSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|