C15H12S2 — CID 101474013
4-phenyl-3,4-dihydroisothiochromene-1-thione (PubChem CID 101474013) has the molecular formula C15H12S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 4-phenyl-3,4-dihydroisothiochromene-1-thione.
| Compound Name | 4-phenyl-3,4-dihydroisothiochromene-1-thione |
|---|---|
| PubChem CID | 101474013 |
| Molecular Formula | C15H12S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-phenyl-3,4-dihydroisothiochromene-1-thione |
| SMILES | S=C1SCC(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H12S2/c16-15-13-9-5-4-8-12(13)14(10-17-15)11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | DDULEJNMBFPTNZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|