C18H18ClN — CID 174477628
1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 174477628) has the molecular formula C18H18ClN and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 174477628 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | ClC1c2ccccc2C(c2ccccc2)CN1C1CC1 |
| InChI | InChI=1S/C18H18ClN/c19-18-16-9-5-4-8-15(16)17(12-20(18)14-10-11-14)13-6-2-1-3-7-13/h1-9,14,17-18H,10-12H2 |
| InChIKey | HTOUALJQJNDDLT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|