C20H19ClF3NO2 — CID 174477630
1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline;2,2,2-trifluoroacetic acid (PubChem CID 174477630) has the molecular formula C20H19ClF3NO2 and a molecular weight of 397.82 g/mol. Its IUPAC name is 1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline;2,2,2-trifluoroacetic acid.
| Compound Name | 1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174477630 |
| Molecular Formula | C20H19ClF3NO2 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-chloro-2-cyclopropyl-4-phenyl-3,4-dihydro-1H-isoquinoline;2,2,2-trifluoroacetic acid |
| SMILES | ClC1c2ccccc2C(c2ccccc2)CN1C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18ClN.C2HF3O2/c19-18-16-9-5-4-8-15(16)17(12-20(18)14-10-11-14)13-6-2-1-3-7-13;3-2(4,5)1(6)7/h1-9,14,17-18H,10-12H2;(H,6,7) |
| InChIKey | YMXCFRAMRNDPIX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|