About 1-cyclopropyl-2,4-diphenylpiperazine
1-cyclopropyl-2,4-diphenylpiperazine (PubChem CID 67588096) has the molecular formula C19H22N2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-cyclopropyl-2,4-diphenylpiperazine.
Molecular Properties
| Compound Name | 1-cyclopropyl-2,4-diphenylpiperazine |
| PubChem CID | 67588096 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-cyclopropyl-2,4-diphenylpiperazine |
| SMILES | c1ccc(C2CN(c3ccccc3)CCN2C2CC2)cc1 |
| InChI | InChI=1S/C19H22N2/c1-3-7-16(8-4-1)19-15-20(17-9-5-2-6-10-17)13-14-21(19)18-11-12-18/h1-10,18-19H,11-15H2 |
| InChIKey | XXQMVSOZBQEFQM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-2,4-diphenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2,4-diphenylpiperazine?
The IUPAC name of 1-cyclopropyl-2,4-diphenylpiperazine (CID 67588096) is 1-cyclopropyl-2,4-diphenylpiperazine.
What is the SMILES notation for 1-cyclopropyl-2,4-diphenylpiperazine?
The canonical SMILES for 1-cyclopropyl-2,4-diphenylpiperazine is c1ccc(C2CN(c3ccccc3)CCN2C2CC2)cc1.
What is the InChIKey of 1-cyclopropyl-2,4-diphenylpiperazine?
The InChIKey is XXQMVSOZBQEFQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2/c1-3-7-16(8-4-1)19-15-20(17-9-5-2-6-10-17)13-14-21(19)18-11-12-18/h1-10,18-19H,11-15H2.
What are the key properties of 1-cyclopropyl-2,4-diphenylpiperazine?
1-cyclopropyl-2,4-diphenylpiperazine has a molecular weight of 278.40 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2,4-diphenylpiperazine is sourced from PubChem (CID 67588096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).