About 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid
1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 102167347) has the molecular formula C23H18O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid |
| PubChem CID | 102167347 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(c2ccccc2)c2ccccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H18O2/c24-23(25)21-15-20(16-9-3-1-4-10-16)18-13-7-8-14-19(18)22(21)17-11-5-2-6-12-17/h1-14,20H,15H2,(H,24,25) |
| InChIKey | FAPFKIFNEHZAGH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid?
The IUPAC name of 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid (CID 102167347) is 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid?
The canonical SMILES for 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid is O=C(O)C1=C(c2ccccc2)c2ccccc2C(c2ccccc2)C1.
What is the InChIKey of 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid?
The InChIKey is FAPFKIFNEHZAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18O2/c24-23(25)21-15-20(16-9-3-1-4-10-16)18-13-7-8-14-19(18)22(21)17-11-5-2-6-12-17/h1-14,20H,15H2,(H,24,25).
What are the key properties of 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid?
1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid has a molecular weight of 326.40 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diphenyl-3,4-dihydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 102167347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).