C29H21BrFN3O3 — CID 126406129
3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126406129) has the molecular formula C29H21BrFN3O3 and a molecular weight of 558.41 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126406129 |
| Molecular Formula | C29H21BrFN3O3 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | 3-[[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c(Br)cc1OCc1ccccc1F |
| InChI | InChI=1S/C29H21BrFN3O3/c1-36-26-15-21(23(30)16-27(26)37-18-20-11-5-7-13-24(20)31)17-32-34-28(19-9-3-2-4-10-19)33-25-14-8-6-12-22(25)29(34)35/h2-17H,18H2,1H3 |
| InChIKey | DMWOHGALSUUACG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|