C30H26N4O2 — CID 126409625
3-[[4-(dimethylamino)-2-phenylmethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126409625) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-2-phenylmethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[4-(dimethylamino)-2-phenylmethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126409625 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-[[4-(dimethylamino)-2-phenylmethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CN(C)c1ccc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H26N4O2/c1-33(2)25-18-17-24(28(19-25)36-21-22-11-5-3-6-12-22)20-31-34-29(23-13-7-4-8-14-23)32-27-16-10-9-15-26(27)30(34)35/h3-20H,21H2,1-2H3 |
| InChIKey | NANYPMMAHWLXOU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|