C27H23F3N4O2 — CID 126281526
3-[[4-(dimethylamino)-2-prop-2-enoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126281526) has the molecular formula C27H23F3N4O2 and a molecular weight of 492.50 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-2-prop-2-enoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[4-(dimethylamino)-2-prop-2-enoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126281526 |
| Molecular Formula | C27H23F3N4O2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-[[4-(dimethylamino)-2-prop-2-enoxyphenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | C=CCOc1cc(N(C)C)ccc1C=Nn1c(-c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H23F3N4O2/c1-4-14-36-24-16-21(33(2)3)13-12-19(24)17-31-34-25(18-8-7-9-20(15-18)27(28,29)30)32-23-11-6-5-10-22(23)26(34)35/h4-13,15-17H,1,14H2,2-3H3 |
| InChIKey | IVLMNIRYBXPMLY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|