C23H22BrN3O6S2 — CID 126416895
2-(3-acetyl-N-methylsulfonylanilino)-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 126416895) has the molecular formula C23H22BrN3O6S2 and a molecular weight of 580.48 g/mol. Its IUPAC name is 2-(3-acetyl-N-methylsulfonylanilino)-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 126416895 |
| Molecular Formula | C23H22BrN3O6S2 |
| Molecular Weight | 580.48 g/mol |
| Exact Mass | 579.01 |
| IUPAC Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Br)cc3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H22BrN3O6S2/c1-16(28)17-4-3-5-21(14-17)27(34(2,30)31)15-23(29)25-19-10-12-22(13-11-19)35(32,33)26-20-8-6-18(24)7-9-20/h3-14,26H,15H2,1-2H3,(H,25,29) |
| InChIKey | XICQOLNEZIMUSC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |