C8H12N2O3 — CID 12641799
3-(2-hydroxyethyl)-1,6-dimethylpyrimidine-2,4-dione (PubChem CID 12641799) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1,6-dimethylpyrimidine-2,4-dione.
| Compound Name | 3-(2-hydroxyethyl)-1,6-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12641799 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-(2-hydroxyethyl)-1,6-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(CCO)c(=O)n1C |
| InChI | InChI=1S/C8H12N2O3/c1-6-5-7(12)10(3-4-11)8(13)9(6)2/h5,11H,3-4H2,1-2H3 |
| InChIKey | ADEOCYXMKZBKCX-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |