C27H28N4O3S3 — CID 126419358
N-[4-[[(2S)-2-ethylpiperidin-1-yl]-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide (PubChem CID 126419358) has the molecular formula C27H28N4O3S3 and a molecular weight of 552.75 g/mol. Its IUPAC name is N-[4-[[(2S)-2-ethylpiperidin-1-yl]-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-[4-[[(2S)-2-ethylpiperidin-1-yl]-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126419358 |
| Molecular Formula | C27H28N4O3S3 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | N-[4-[[(2S)-2-ethylpiperidin-1-yl]-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetamide |
| SMILES | CC[C@H]1CCCCN1S(=O)(O)=C1C=CC(=NC(=O)CSc2ncnc3scc(-c4ccccc4)c23)C=C1 |
| InChI | InChI=1S/C27H28N4O3S3/c1-2-21-10-6-7-15-31(21)37(33,34)22-13-11-20(12-14-22)30-24(32)17-36-27-25-23(19-8-4-3-5-9-19)16-35-26(25)28-18-29-27/h3-5,8-9,11-14,16,18,21H,2,6-7,10,15,17H2,1H3,(H,33,34)/t21-/m0/s1 |
| InChIKey | SJDUDXXNXGHHTQ-NRFANRHFSA-N |
| XLogP | 5.65 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|