About benzoyl(triethyl)azanium bromide
benzoyl(triethyl)azanium bromide (PubChem CID 12641945) has the molecular formula C13H20BrNO
and a molecular weight of 286.21 g/mol. Its IUPAC name is benzoyl(triethyl)azanium bromide.
Molecular Properties
| Compound Name | benzoyl(triethyl)azanium bromide |
| PubChem CID | 12641945 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | benzoyl(triethyl)azanium bromide |
| SMILES | CC[N+](CC)(CC)C(=O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C13H20NO.BrH/c1-4-14(5-2,6-3)13(15)12-10-8-7-9-11-12;/h7-11H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JKFLHTTXSUKBES-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzoyl(triethyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl(triethyl)azanium bromide?
The IUPAC name of benzoyl(triethyl)azanium bromide (CID 12641945) is benzoyl(triethyl)azanium bromide.
What is the SMILES notation for benzoyl(triethyl)azanium bromide?
The canonical SMILES for benzoyl(triethyl)azanium bromide is CC[N+](CC)(CC)C(=O)c1ccccc1.[Br-].
What is the InChIKey of benzoyl(triethyl)azanium bromide?
The InChIKey is JKFLHTTXSUKBES-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H20NO.BrH/c1-4-14(5-2,6-3)13(15)12-10-8-7-9-11-12;/h7-11H,4-6H2,1-3H3;1H/q+1;/p-1.
What are the key properties of benzoyl(triethyl)azanium bromide?
benzoyl(triethyl)azanium bromide has a molecular weight of 286.21 g/mol, XLogP of -0.29, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl(triethyl)azanium bromide is sourced from PubChem (CID 12641945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).