C18H22N2O3S — CID 126422665
N-[(1R,3S)-3-methoxyspiro[3.3]heptan-1-yl]-1-quinolin-8-ylmethanesulfonamide (PubChem CID 126422665) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[(1R,3S)-3-methoxyspiro[3.3]heptan-1-yl]-1-quinolin-8-ylmethanesulfonamide.
| Compound Name | N-[(1R,3S)-3-methoxyspiro[3.3]heptan-1-yl]-1-quinolin-8-ylmethanesulfonamide |
|---|---|
| PubChem CID | 126422665 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(1R,3S)-3-methoxyspiro[3.3]heptan-1-yl]-1-quinolin-8-ylmethanesulfonamide |
| SMILES | CO[C@H]1C[C@@H](NS(=O)(=O)Cc2cccc3cccnc23)C12CCC2 |
| InChI | InChI=1S/C18H22N2O3S/c1-23-16-11-15(18(16)8-4-9-18)20-24(21,22)12-14-6-2-5-13-7-3-10-19-17(13)14/h2-3,5-7,10,15-16,20H,4,8-9,11-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | SRFGNXDAUVKDBV-CVEARBPZSA-N |
| XLogP | 2.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |