C18H18N4OS — CID 126422724
(3R)-1-[2-(5-methylthiophen-2-yl)quinazolin-4-yl]pyrrolidine-3-carboxamide (PubChem CID 126422724) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is (3R)-1-[2-(5-methylthiophen-2-yl)quinazolin-4-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(5-methylthiophen-2-yl)quinazolin-4-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126422724 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (3R)-1-[2-(5-methylthiophen-2-yl)quinazolin-4-yl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(-c2nc(N3CC[C@@H](C(N)=O)C3)c3ccccc3n2)s1 |
| InChI | InChI=1S/C18H18N4OS/c1-11-6-7-15(24-11)17-20-14-5-3-2-4-13(14)18(21-17)22-9-8-12(10-22)16(19)23/h2-7,12H,8-10H2,1H3,(H2,19,23)/t12-/m1/s1 |
| InChIKey | IMHBJGGADLHHDO-GFCCVEGCSA-N |
| XLogP | 2.98 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |