C19H30N4O2 — CID 126426190
4-(2,6-dimethyl-4-pyridinyl)-N-[3-[(3R)-oxolan-3-yl]propyl]piperazine-1-carboxamide (PubChem CID 126426190) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-pyridinyl)-N-[3-[(3R)-oxolan-3-yl]propyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,6-dimethyl-4-pyridinyl)-N-[3-[(3R)-oxolan-3-yl]propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 126426190 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 4-(2,6-dimethyl-4-pyridinyl)-N-[3-[(3R)-oxolan-3-yl]propyl]piperazine-1-carboxamide |
| SMILES | Cc1cc(N2CCN(C(=O)NCCC[C@@H]3CCOC3)CC2)cc(C)n1 |
| InChI | InChI=1S/C19H30N4O2/c1-15-12-18(13-16(2)21-15)22-7-9-23(10-8-22)19(24)20-6-3-4-17-5-11-25-14-17/h12-13,17H,3-11,14H2,1-2H3,(H,20,24)/t17-/m1/s1 |
| InChIKey | SCGOLVKSYFOVKL-QGZVFWFLSA-N |
| XLogP | 2.35 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|