C14H18ClN3O4S — CID 126427638
N-[(3R)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(methanesulfonamido)propanamide (PubChem CID 126427638) has the molecular formula C14H18ClN3O4S and a molecular weight of 359.84 g/mol. Its IUPAC name is N-[(3R)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(methanesulfonamido)propanamide.
| Compound Name | N-[(3R)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 126427638 |
| Molecular Formula | C14H18ClN3O4S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[(3R)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(methanesulfonamido)propanamide |
| SMILES | CS(=O)(=O)NCCC(=O)N[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H18ClN3O4S/c1-23(21,22)16-7-6-13(19)17-11-8-14(20)18(9-11)12-4-2-10(15)3-5-12/h2-5,11,16H,6-9H2,1H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | JIFVMAWHORHNRD-LLVKDONJSA-N |
| XLogP | 0.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |