C15H18Cl2N2O2 — CID 43971221
3-chloro-N-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide (PubChem CID 43971221) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 3-chloro-N-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 43971221 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-chloro-N-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-15(2,9-16)14(21)18-11-7-13(20)19(8-11)12-5-3-10(17)4-6-12/h3-6,11H,7-9H2,1-2H3,(H,18,21) |
| InChIKey | SXMJAKXWPCSKMW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|