C17H23ClN2O3 — CID 7548901
3-chloro-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide (PubChem CID 7548901) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 3-chloro-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 7548901 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-chloro-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]-2,2-dimethylpropanamide |
| SMILES | CCOc1ccc(N2C[C@@H](NC(=O)C(C)(C)CCl)CC2=O)cc1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-4-23-14-7-5-13(6-8-14)20-10-12(9-15(20)21)19-16(22)17(2,3)11-18/h5-8,12H,4,9-11H2,1-3H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | IJXHNYIPOQITLX-LBPRGKRZSA-N |
| XLogP | 2.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|