C19H18FN5O2 — CID 126430189
(2R)-1-[3-(4-fluorophenoxy)azetidin-1-yl]-2-(5-methyltetrazol-1-yl)-2-phenylethanone (PubChem CID 126430189) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is (2R)-1-[3-(4-fluorophenoxy)azetidin-1-yl]-2-(5-methyltetrazol-1-yl)-2-phenylethanone.
| Compound Name | (2R)-1-[3-(4-fluorophenoxy)azetidin-1-yl]-2-(5-methyltetrazol-1-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 126430189 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R)-1-[3-(4-fluorophenoxy)azetidin-1-yl]-2-(5-methyltetrazol-1-yl)-2-phenylethanone |
| SMILES | Cc1nnnn1[C@@H](C(=O)N1CC(Oc2ccc(F)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H18FN5O2/c1-13-21-22-23-25(13)18(14-5-3-2-4-6-14)19(26)24-11-17(12-24)27-16-9-7-15(20)8-10-16/h2-10,17-18H,11-12H2,1H3/t18-/m1/s1 |
| InChIKey | CTHAXRXNOIGMPU-GOSISDBHSA-N |
| XLogP | 2.00 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |