C16H19N5O — CID 119070972
1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-(5-methyltetrazol-1-yl)-2-phenylethanone (PubChem CID 119070972) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-(5-methyltetrazol-1-yl)-2-phenylethanone.
| Compound Name | 1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-(5-methyltetrazol-1-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 119070972 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-(5-methyltetrazol-1-yl)-2-phenylethanone |
| SMILES | CC1=CCN(C(=O)C(c2ccccc2)n2nnnc2C)CC1 |
| InChI | InChI=1S/C16H19N5O/c1-12-8-10-20(11-9-12)16(22)15(14-6-4-3-5-7-14)21-13(2)17-18-19-21/h3-8,15H,9-11H2,1-2H3 |
| InChIKey | OSSIYZVHOFHVOD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|