C18H25N3O6 — CID 126432592
(2S)-2-[[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]amino]butanedioic acid (PubChem CID 126432592) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is (2S)-2-[[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 126432592 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (2S)-2-[[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]amino]butanedioic acid |
| SMILES | COc1ccc(N2CCN(C(=O)N[C@@H](CC(=O)O)C(=O)O)CC2(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O6/c1-18(2)11-20(17(26)19-14(16(24)25)10-15(22)23)8-9-21(18)12-4-6-13(27-3)7-5-12/h4-7,14H,8-11H2,1-3H3,(H,19,26)(H,22,23)(H,24,25)/t14-/m0/s1 |
| InChIKey | VLJUDRYWHKNVIG-AWEZNQCLSA-N |
| XLogP | 1.23 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|