C21H32N2O3 — CID 70722230
(2,2-dimethyloxan-4-yl)-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]methanone (PubChem CID 70722230) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2,2-dimethyloxan-4-yl)-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]methanone.
| Compound Name | (2,2-dimethyloxan-4-yl)-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 70722230 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (2,2-dimethyloxan-4-yl)-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCOC(C)(C)C3)CC2(C)C)cc1 |
| InChI | InChI=1S/C21H32N2O3/c1-20(2)15-22(19(24)16-10-13-26-21(3,4)14-16)11-12-23(20)17-6-8-18(25-5)9-7-17/h6-9,16H,10-15H2,1-5H3 |
| InChIKey | ZSLUTWQJOVAUQD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|