C21H27N3O3 — CID 70709388
3-[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 70709388) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 70709388 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-3,3-dimethylpiperazine-1-carbonyl]-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3c(C)cc(C)[nH]c3=O)CC2(C)C)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-14-12-15(2)22-19(25)18(14)20(26)23-10-11-24(21(3,4)13-23)16-6-8-17(27-5)9-7-16/h6-9,12H,10-11,13H2,1-5H3,(H,22,25) |
| InChIKey | LWJNDQFHEIXBKS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|