C18H29N5O — CID 126433094
3-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea (PubChem CID 126433094) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126433094 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 3-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea |
| SMILES | CN1CCC(N(C)C(=O)Nc2ccnn2C[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C18H29N5O/c1-21-12-9-16(10-13-21)22(2)18(24)20-17-8-11-19-23(17)14-15-6-4-3-5-7-15/h3-4,8,11,15-16H,5-7,9-10,12-14H2,1-2H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | XZBCRRHPXAVTJD-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|