C21H27ClN2O2 — CID 126435536
1-[(4-chlorophenyl)methyl]-3-[(1S)-1-(4-ethylphenyl)ethyl]-1-(3-hydroxypropyl)urea (PubChem CID 126435536) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[(1S)-1-(4-ethylphenyl)ethyl]-1-(3-hydroxypropyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[(1S)-1-(4-ethylphenyl)ethyl]-1-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 126435536 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[(1S)-1-(4-ethylphenyl)ethyl]-1-(3-hydroxypropyl)urea |
| SMILES | CCc1ccc([C@H](C)NC(=O)N(CCCO)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H27ClN2O2/c1-3-17-5-9-19(10-6-17)16(2)23-21(26)24(13-4-14-25)15-18-7-11-20(22)12-8-18/h5-12,16,25H,3-4,13-15H2,1-2H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | FWFUSNQPNQMRGR-INIZCTEOSA-N |
| XLogP | 4.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |