C16H25ClN2O2 — CID 126448790
1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-[(2R)-3-methylbutan-2-yl]urea (PubChem CID 126448790) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-[(2R)-3-methylbutan-2-yl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-[(2R)-3-methylbutan-2-yl]urea |
|---|---|
| PubChem CID | 126448790 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3-[(2R)-3-methylbutan-2-yl]urea |
| SMILES | CC(C)[C@@H](C)NC(=O)N(CCCO)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-12(2)13(3)18-16(21)19(9-4-10-20)11-14-5-7-15(17)8-6-14/h5-8,12-13,20H,4,9-11H2,1-3H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | PWKYURFHIDDQGU-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |