C18H25ClN4O2 — CID 72857964
3-(2-butan-2-ylpyrazol-3-yl)-1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)urea (PubChem CID 72857964) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is 3-(2-butan-2-ylpyrazol-3-yl)-1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)urea.
| Compound Name | 3-(2-butan-2-ylpyrazol-3-yl)-1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 72857964 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 3-(2-butan-2-ylpyrazol-3-yl)-1-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)urea |
| SMILES | CCC(C)n1nccc1NC(=O)N(CCCO)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN4O2/c1-3-14(2)23-17(9-10-20-23)21-18(25)22(11-4-12-24)13-15-5-7-16(19)8-6-15/h5-10,14,24H,3-4,11-13H2,1-2H3,(H,21,25) |
| InChIKey | UIWDSOFDPGKOQW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |