C18H25N5O3 — CID 126439155
(8aR)-3-oxo-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide (PubChem CID 126439155) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is (8aR)-3-oxo-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide.
| Compound Name | (8aR)-3-oxo-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 126439155 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (8aR)-3-oxo-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazine-7-carboxamide |
| SMILES | O=C(NC1CCN(Cc2cccnc2)CC1)N1CCN2C(=O)OC[C@H]2C1 |
| InChI | InChI=1S/C18H25N5O3/c24-17(22-8-9-23-16(12-22)13-26-18(23)25)20-15-3-6-21(7-4-15)11-14-2-1-5-19-10-14/h1-2,5,10,15-16H,3-4,6-9,11-13H2,(H,20,24)/t16-/m1/s1 |
| InChIKey | JVDUSBKWTBNIGG-MRXNPFEDSA-N |
| XLogP | 0.89 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |