C16H18F3N5O — CID 126440780
1-[4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-3-[(3S)-pyrrolidin-3-yl]urea (PubChem CID 126440780) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is 1-[4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-3-[(3S)-pyrrolidin-3-yl]urea.
| Compound Name | 1-[4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-3-[(3S)-pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 126440780 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[4-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-3-[(3S)-pyrrolidin-3-yl]urea |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(NC(=O)N[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C16H18F3N5O/c1-24-13(8-14(23-24)16(17,18)19)10-2-4-11(5-3-10)21-15(25)22-12-6-7-20-9-12/h2-5,8,12,20H,6-7,9H2,1H3,(H2,21,22,25)/t12-/m0/s1 |
| InChIKey | MOZFBYMLBFKVDA-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |