C19H33N5O2 — CID 126445216
1-cyclopropyl-3-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea (PubChem CID 126445216) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 126445216 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 1-cyclopropyl-3-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
| SMILES | Cc1nn(C)c(C)c1CN(C(=O)NCCCN1CCC[C@@H](O)C1)C1CC1 |
| InChI | InChI=1S/C19H33N5O2/c1-14-18(15(2)22(3)21-14)13-24(16-7-8-16)19(26)20-9-5-11-23-10-4-6-17(25)12-23/h16-17,25H,4-13H2,1-3H3,(H,20,26)/t17-/m1/s1 |
| InChIKey | FDGFQOVRPOJLNS-QGZVFWFLSA-N |
| XLogP | 1.56 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|