C16H31N5O2 — CID 138045016
3-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea (PubChem CID 138045016) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea.
| Compound Name | 3-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 138045016 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
| SMILES | COCCN(Cc1c(C)nn(C)c1C)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C16H31N5O2/c1-13-15(14(2)20(5)18-13)12-21(10-11-23-6)16(22)17-8-7-9-19(3)4/h7-12H2,1-6H3,(H,17,22) |
| InChIKey | KZNQNYQAOUMHJK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|