C19H29N5O3 — CID 146111304
(5S,7R)-N-(2-methoxyethyl)-5,7-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111304) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5S,7R)-N-(2-methoxyethyl)-5,7-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-N-(2-methoxyethyl)-5,7-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111304 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (5S,7R)-N-(2-methoxyethyl)-5,7-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | COCCN(Cc1c(C)nn(C)c1C)C(=O)c1n[nH]c2c1C[C@H](C)O[C@@H]2C |
| InChI | InChI=1S/C19H29N5O3/c1-11-9-15-17(14(4)27-11)20-21-18(15)19(25)24(7-8-26-6)10-16-12(2)22-23(5)13(16)3/h11,14H,7-10H2,1-6H3,(H,20,21)/t11-,14+/m0/s1 |
| InChIKey | LNKBLBMXUFXMNH-SMDDNHRTSA-N |
| XLogP | 2.07 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |