About N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide
N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide (PubChem CID 77087479) has the molecular formula C15H25N3O3
and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide |
| PubChem CID | 77087479 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide |
| SMILES | COCCN(Cc1c(C)nn(C)c1C)C(=O)C1CCOC1 |
| InChI | InChI=1S/C15H25N3O3/c1-11-14(12(2)17(3)16-11)9-18(6-8-20-4)15(19)13-5-7-21-10-13/h13H,5-10H2,1-4H3 |
| InChIKey | ATORBVRBFFICNR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide?
The IUPAC name of N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide (CID 77087479) is N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide.
What is the SMILES notation for N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide?
The canonical SMILES for N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide is COCCN(Cc1c(C)nn(C)c1C)C(=O)C1CCOC1.
What is the InChIKey of N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide?
The InChIKey is ATORBVRBFFICNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O3/c1-11-14(12(2)17(3)16-11)9-18(6-8-20-4)15(19)13-5-7-21-10-13/h13H,5-10H2,1-4H3.
What are the key properties of N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide?
N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide has a molecular weight of 295.38 g/mol, XLogP of 1.05, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]oxolane-3-carboxamide is sourced from PubChem (CID 77087479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).