C13H21ClN4O2 — CID 125155609
4-chloro-N-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 125155609) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-chloro-N-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 125155609 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-chloro-N-[3-[(3R)-3-hydroxypiperidin-1-yl]propyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCCCN2CCC[C@@H](O)C2)c1Cl |
| InChI | InChI=1S/C13H21ClN4O2/c1-9-11(14)12(17-16-9)13(20)15-5-3-7-18-6-2-4-10(19)8-18/h10,19H,2-8H2,1H3,(H,15,20)(H,16,17)/t10-/m1/s1 |
| InChIKey | JCNXTWZCTBUUQR-SNVBAGLBSA-N |
| XLogP | 0.95 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|