C18H26N6O2 — CID 125167351
1-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]-3-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]urea (PubChem CID 125167351) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]-3-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]urea.
| Compound Name | 1-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]-3-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 125167351 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]-3-[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]urea |
| SMILES | Cc1ccc(-n2cnnc2)cc1NC(=O)NCCCN1CCC[C@H](O)C1 |
| InChI | InChI=1S/C18H26N6O2/c1-14-5-6-15(24-12-20-21-13-24)10-17(14)22-18(26)19-7-3-9-23-8-2-4-16(25)11-23/h5-6,10,12-13,16,25H,2-4,7-9,11H2,1H3,(H2,19,22,26)/t16-/m0/s1 |
| InChIKey | MSKBFSNQWGKPFT-INIZCTEOSA-N |
| XLogP | 1.54 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|