C17H23FN4O4 — CID 125164881
1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea (PubChem CID 125164881) has the molecular formula C17H23FN4O4 and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea.
| Compound Name | 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 125164881 |
| Molecular Formula | C17H23FN4O4 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea |
| SMILES | O=C1COc2c(F)cc(NC(=O)NCCCN3CCC[C@H](O)C3)cc2N1 |
| InChI | InChI=1S/C17H23FN4O4/c18-13-7-11(8-14-16(13)26-10-15(24)21-14)20-17(25)19-4-2-6-22-5-1-3-12(23)9-22/h7-8,12,23H,1-6,9-10H2,(H,21,24)(H2,19,20,25)/t12-/m0/s1 |
| InChIKey | FUAUPLPURHQVAT-LBPRGKRZSA-N |
| XLogP | 1.12 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|