About 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea
1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea (PubChem CID 125164881) has the molecular formula C17H23FN4O4
and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea.
Molecular Properties
| Compound Name | 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea |
| PubChem CID | 125164881 |
| Molecular Formula | C17H23FN4O4 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea |
| SMILES | O=C1COc2c(F)cc(NC(=O)NCCCN3CCC[C@H](O)C3)cc2N1 |
| InChI | InChI=1S/C17H23FN4O4/c18-13-7-11(8-14-16(13)26-10-15(24)21-14)20-17(25)19-4-2-6-22-5-1-3-12(23)9-22/h7-8,12,23H,1-6,9-10H2,(H,21,24)(H2,19,20,25)/t12-/m0/s1 |
| InChIKey | FUAUPLPURHQVAT-LBPRGKRZSA-N |
| XLogP | 1.12 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea?
The IUPAC name of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea (CID 125164881) is 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea.
What is the SMILES notation for 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea?
The canonical SMILES for 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea is O=C1COc2c(F)cc(NC(=O)NCCCN3CCC[C@H](O)C3)cc2N1.
What is the InChIKey of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea?
The InChIKey is FUAUPLPURHQVAT-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H23FN4O4/c18-13-7-11(8-14-16(13)26-10-15(24)21-14)20-17(25)19-4-2-6-22-5-1-3-12(23)9-22/h7-8,12,23H,1-6,9-10H2,(H,21,24)(H2,19,20,25)/t12-/m0/s1.
What are the key properties of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea?
1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea has a molecular weight of 366.39 g/mol, XLogP of 1.12, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[3-[(3S)-3-hydroxypiperidin-1-yl]propyl]urea is sourced from PubChem (CID 125164881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).