About 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea
1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea (PubChem CID 126435100) has the molecular formula C18H22FN3O4
and a molecular weight of 363.39 g/mol. Its IUPAC name is 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea.
Molecular Properties
| Compound Name | 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea |
| PubChem CID | 126435100 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea |
| SMILES | O=C1COc2c(F)cc(NC(=O)N[C@H]3COC4(CCCCC4)C3)cc2N1 |
| InChI | InChI=1S/C18H22FN3O4/c19-13-6-11(7-14-16(13)25-10-15(23)22-14)20-17(24)21-12-8-18(26-9-12)4-2-1-3-5-18/h6-7,12H,1-5,8-10H2,(H,22,23)(H2,20,21,24)/t12-/m1/s1 |
| InChIKey | ARUMNZOIIJMWFN-GFCCVEGCSA-N |
| XLogP | 2.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea?
The IUPAC name of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea (CID 126435100) is 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea.
What is the SMILES notation for 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea?
The canonical SMILES for 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea is O=C1COc2c(F)cc(NC(=O)N[C@H]3COC4(CCCCC4)C3)cc2N1.
What is the InChIKey of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea?
The InChIKey is ARUMNZOIIJMWFN-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H22FN3O4/c19-13-6-11(7-14-16(13)25-10-15(23)22-14)20-17(24)21-12-8-18(26-9-12)4-2-1-3-5-18/h6-7,12H,1-5,8-10H2,(H,22,23)(H2,20,21,24)/t12-/m1/s1.
What are the key properties of 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea?
1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea has a molecular weight of 363.39 g/mol, XLogP of 2.77, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-fluoro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[(3R)-1-oxaspiro[4.5]decan-3-yl]urea is sourced from PubChem (CID 126435100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).