C19H30N4O2S — CID 126446346
4-[1-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperidin-4-yl]thiomorpholine (PubChem CID 126446346) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is 4-[1-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperidin-4-yl]thiomorpholine.
| Compound Name | 4-[1-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperidin-4-yl]thiomorpholine |
|---|---|
| PubChem CID | 126446346 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-[1-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperidin-4-yl]thiomorpholine |
| SMILES | COCc1nc([C@@H]2CCOC2)cc(N2CCC(N3CCSCC3)CC2)n1 |
| InChI | InChI=1S/C19H30N4O2S/c1-24-14-18-20-17(15-4-9-25-13-15)12-19(21-18)23-5-2-16(3-6-23)22-7-10-26-11-8-22/h12,15-16H,2-11,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | YXVSOESNSWOTHD-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |