C22H25N3O2 — CID 126450683
3-[4-[(3R)-3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]phenyl]benzonitrile (PubChem CID 126450683) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-[4-[(3R)-3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]phenyl]benzonitrile.
| Compound Name | 3-[4-[(3R)-3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 126450683 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-[4-[(3R)-3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]phenyl]benzonitrile |
| SMILES | CN(C)C[C@]1(O)CCCN(C(=O)c2ccc(-c3cccc(C#N)c3)cc2)C1 |
| InChI | InChI=1S/C22H25N3O2/c1-24(2)15-22(27)11-4-12-25(16-22)21(26)19-9-7-18(8-10-19)20-6-3-5-17(13-20)14-23/h3,5-10,13,27H,4,11-12,15-16H2,1-2H3/t22-/m1/s1 |
| InChIKey | IRGIZANPPOIZNJ-JOCHJYFZSA-N |
| XLogP | 2.75 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |