C18H26N2O5 — CID 56890831
methyl 3-[3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]-5-methoxybenzoate (PubChem CID 56890831) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 3-[3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]-5-methoxybenzoate.
| Compound Name | methyl 3-[3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]-5-methoxybenzoate |
|---|---|
| PubChem CID | 56890831 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl 3-[3-[(dimethylamino)methyl]-3-hydroxypiperidine-1-carbonyl]-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(C(=O)N2CCCC(O)(CN(C)C)C2)c1 |
| InChI | InChI=1S/C18H26N2O5/c1-19(2)11-18(23)6-5-7-20(12-18)16(21)13-8-14(17(22)25-4)10-15(9-13)24-3/h8-10,23H,5-7,11-12H2,1-4H3 |
| InChIKey | NZOXQALYKPZRQI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |