C19H28N2O4 — CID 167869171
2-(3-acetylphenoxy)-1-[3-[(dimethylamino)methyl]-3-hydroxypiperidin-1-yl]propan-1-one (PubChem CID 167869171) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-1-[3-[(dimethylamino)methyl]-3-hydroxypiperidin-1-yl]propan-1-one.
| Compound Name | 2-(3-acetylphenoxy)-1-[3-[(dimethylamino)methyl]-3-hydroxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 167869171 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-(3-acetylphenoxy)-1-[3-[(dimethylamino)methyl]-3-hydroxypiperidin-1-yl]propan-1-one |
| SMILES | CC(=O)c1cccc(OC(C)C(=O)N2CCCC(O)(CN(C)C)C2)c1 |
| InChI | InChI=1S/C19H28N2O4/c1-14(22)16-7-5-8-17(11-16)25-15(2)18(23)21-10-6-9-19(24,13-21)12-20(3)4/h5,7-8,11,15,24H,6,9-10,12-13H2,1-4H3 |
| InChIKey | SSDKMCPKQMTTCQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |