C19H29NO3 — CID 126453786
N-[3-(2,5-dimethylphenoxy)propyl]-N-methyl-2-[(3R)-oxan-3-yl]acetamide (PubChem CID 126453786) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is N-[3-(2,5-dimethylphenoxy)propyl]-N-methyl-2-[(3R)-oxan-3-yl]acetamide.
| Compound Name | N-[3-(2,5-dimethylphenoxy)propyl]-N-methyl-2-[(3R)-oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 126453786 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-[3-(2,5-dimethylphenoxy)propyl]-N-methyl-2-[(3R)-oxan-3-yl]acetamide |
| SMILES | Cc1ccc(C)c(OCCCN(C)C(=O)C[C@H]2CCCOC2)c1 |
| InChI | InChI=1S/C19H29NO3/c1-15-7-8-16(2)18(12-15)23-11-5-9-20(3)19(21)13-17-6-4-10-22-14-17/h7-8,12,17H,4-6,9-11,13-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | GLVJPDNCSMQXSM-QGZVFWFLSA-N |
| XLogP | 3.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|