C19H27N3O4 — CID 97149351
2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[3-(2,5-dimethylphenoxy)propyl]-N-methylacetamide (PubChem CID 97149351) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[3-(2,5-dimethylphenoxy)propyl]-N-methylacetamide.
| Compound Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[3-(2,5-dimethylphenoxy)propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 97149351 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[3-(2,5-dimethylphenoxy)propyl]-N-methylacetamide |
| SMILES | Cc1ccc(C)c(OCCCN(C)C(=O)C[C@H]2C(=O)N(C)C(=O)N2C)c1 |
| InChI | InChI=1S/C19H27N3O4/c1-13-7-8-14(2)16(11-13)26-10-6-9-20(3)17(23)12-15-18(24)22(5)19(25)21(15)4/h7-8,11,15H,6,9-10,12H2,1-5H3/t15-/m0/s1 |
| InChIKey | NZNBJNBVPJEYKO-HNNXBMFYSA-N |
| XLogP | 1.81 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|