C18H24N2O3 — CID 126454768
N-[(3S)-4,4-dimethyloxolan-3-yl]-2-(4-ethoxy-1H-indol-3-yl)acetamide (PubChem CID 126454768) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(3S)-4,4-dimethyloxolan-3-yl]-2-(4-ethoxy-1H-indol-3-yl)acetamide.
| Compound Name | N-[(3S)-4,4-dimethyloxolan-3-yl]-2-(4-ethoxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 126454768 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[(3S)-4,4-dimethyloxolan-3-yl]-2-(4-ethoxy-1H-indol-3-yl)acetamide |
| SMILES | CCOc1cccc2[nH]cc(CC(=O)N[C@@H]3COCC3(C)C)c12 |
| InChI | InChI=1S/C18H24N2O3/c1-4-23-14-7-5-6-13-17(14)12(9-19-13)8-16(21)20-15-10-22-11-18(15,2)3/h5-7,9,15,19H,4,8,10-11H2,1-3H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | BJYIMUUWIWNHRG-OAHLLOKOSA-N |
| XLogP | 2.65 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |