C17H20N2O3 — CID 125419727
2-(4-ethoxy-1H-indol-3-yl)-N-[(2S)-2-hydroxypent-4-ynyl]acetamide (PubChem CID 125419727) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(4-ethoxy-1H-indol-3-yl)-N-[(2S)-2-hydroxypent-4-ynyl]acetamide.
| Compound Name | 2-(4-ethoxy-1H-indol-3-yl)-N-[(2S)-2-hydroxypent-4-ynyl]acetamide |
|---|---|
| PubChem CID | 125419727 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(4-ethoxy-1H-indol-3-yl)-N-[(2S)-2-hydroxypent-4-ynyl]acetamide |
| SMILES | C#CC[C@H](O)CNC(=O)Cc1c[nH]c2cccc(OCC)c12 |
| InChI | InChI=1S/C17H20N2O3/c1-3-6-13(20)11-19-16(21)9-12-10-18-14-7-5-8-15(17(12)14)22-4-2/h1,5,7-8,10,13,18,20H,4,6,9,11H2,2H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | KVZRQHXECUMDMF-ZDUSSCGKSA-N |
| XLogP | 1.61 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|