About N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide
N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide (PubChem CID 126454819) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide |
| PubChem CID | 126454819 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)n1ccc(C(=O)NC[C@@H]2CCOC(C)(C)C2)n1 |
| InChI | InChI=1S/C15H25N3O2/c1-11(2)18-7-5-13(17-18)14(19)16-10-12-6-8-20-15(3,4)9-12/h5,7,11-12H,6,8-10H2,1-4H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | WOJPYVAWAFDGDF-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide?
The IUPAC name of N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide (CID 126454819) is N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide.
What is the SMILES notation for N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide?
The canonical SMILES for N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide is CC(C)n1ccc(C(=O)NC[C@@H]2CCOC(C)(C)C2)n1.
What is the InChIKey of N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide?
The InChIKey is WOJPYVAWAFDGDF-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-11(2)18-7-5-13(17-18)14(19)16-10-12-6-8-20-15(3,4)9-12/h5,7,11-12H,6,8-10H2,1-4H3,(H,16,19)/t12-/m1/s1.
What are the key properties of N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide?
N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide has a molecular weight of 279.38 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4R)-2,2-dimethyloxan-4-yl]methyl]-1-propan-2-ylpyrazole-3-carboxamide is sourced from PubChem (CID 126454819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).