C17H24N2O4S — CID 126457873
4-acetyl-N-cycloheptyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 126457873) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-acetyl-N-cycloheptyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | 4-acetyl-N-cycloheptyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 126457873 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-acetyl-N-cycloheptyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | CC(=O)N1CCOc2cc(S(=O)(=O)NC3CCCCCC3)ccc21 |
| InChI | InChI=1S/C17H24N2O4S/c1-13(20)19-10-11-23-17-12-15(8-9-16(17)19)24(21,22)18-14-6-4-2-3-5-7-14/h8-9,12,14,18H,2-7,10-11H2,1H3 |
| InChIKey | SHMPMRKMPCXRFR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |