C18H25ClN2O4S — CID 22550876
4-acetyl-6-chloro-N-cyclooctyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 22550876) has the molecular formula C18H25ClN2O4S and a molecular weight of 400.93 g/mol. Its IUPAC name is 4-acetyl-6-chloro-N-cyclooctyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | 4-acetyl-6-chloro-N-cyclooctyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 22550876 |
| Molecular Formula | C18H25ClN2O4S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-acetyl-6-chloro-N-cyclooctyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | CC(=O)N1CCOc2cc(S(=O)(=O)NC3CCCCCCC3)c(Cl)cc21 |
| InChI | InChI=1S/C18H25ClN2O4S/c1-13(22)21-9-10-25-17-12-18(15(19)11-16(17)21)26(23,24)20-14-7-5-3-2-4-6-8-14/h11-12,14,20H,2-10H2,1H3 |
| InChIKey | UJEQMLXDJGBDJV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |