C23H22ClN3O2S — CID 126461905
(3S,7S,8aS)-3-benzyl-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 126461905) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is (3S,7S,8aS)-3-benzyl-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-3-benzyl-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 126461905 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (3S,7S,8aS)-3-benzyl-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N2C[C@@H](NCc3sc4ccccc4c3Cl)C[C@@H]12 |
| InChI | InChI=1S/C23H22ClN3O2S/c24-21-16-8-4-5-9-19(16)30-20(21)12-25-15-11-18-22(28)26-17(23(29)27(18)13-15)10-14-6-2-1-3-7-14/h1-9,15,17-18,25H,10-13H2,(H,26,28)/t15-,17-,18-/m0/s1 |
| InChIKey | AKSHZGWWZAZTGC-SZMVWBNQSA-N |
| XLogP | 3.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |